C22H33N3O4 — CID 155998319
(4R,5R,6S)-8-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-6-methoxy-2-oxa-8-azabicyclo[11.4.0]heptadeca-1(17),13,15-triene-4,5-diol (PubChem CID 155998319) has the molecular formula C22H33N3O4 and a molecular weight of 403.52 g/mol. Its IUPAC name is (4R,5R,6S)-8-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-6-methoxy-2-oxa-8-azabicyclo[11.4.0]heptadeca-1(17),13,15-triene-4,5-diol.
| Compound Name | (4R,5R,6S)-8-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-6-methoxy-2-oxa-8-azabicyclo[11.4.0]heptadeca-1(17),13,15-triene-4,5-diol |
|---|---|
| PubChem CID | 155998319 |
| Molecular Formula | C22H33N3O4 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | (4R,5R,6S)-8-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-6-methoxy-2-oxa-8-azabicyclo[11.4.0]heptadeca-1(17),13,15-triene-4,5-diol |
| SMILES | CO[C@H]1CN(Cc2c(C)n[nH]c2C)CCCCc2ccccc2OC[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C22H33N3O4/c1-15-18(16(2)24-23-15)12-25-11-7-6-9-17-8-4-5-10-20(17)29-14-19(26)22(27)21(13-25)28-3/h4-5,8,10,19,21-22,26-27H,6-7,9,11-14H2,1-3H3,(H,23,24)/t19-,21+,22-/m1/s1 |
| InChIKey | MZKWFEUVHBJKRF-BAGYTPMASA-N |
| XLogP | 1.98 |
| TPSA | 90.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |