C22H32FN3O3 — CID 155998464
(4R,5S)-8-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-16-fluoro-2-oxa-8-azabicyclo[12.4.0]octadeca-1(14),15,17-triene-4,5-diol (PubChem CID 155998464) has the molecular formula C22H32FN3O3 and a molecular weight of 405.51 g/mol. Its IUPAC name is (4R,5S)-8-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-16-fluoro-2-oxa-8-azabicyclo[12.4.0]octadeca-1(14),15,17-triene-4,5-diol.
| Compound Name | (4R,5S)-8-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-16-fluoro-2-oxa-8-azabicyclo[12.4.0]octadeca-1(14),15,17-triene-4,5-diol |
|---|---|
| PubChem CID | 155998464 |
| Molecular Formula | C22H32FN3O3 |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | (4R,5S)-8-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-16-fluoro-2-oxa-8-azabicyclo[12.4.0]octadeca-1(14),15,17-triene-4,5-diol |
| SMILES | Cc1n[nH]c(C)c1CN1CCCCCc2cc(F)ccc2OC[C@@H](O)[C@@H](O)CC1 |
| InChI | InChI=1S/C22H32FN3O3/c1-15-19(16(2)25-24-15)13-26-10-5-3-4-6-17-12-18(23)7-8-22(17)29-14-21(28)20(27)9-11-26/h7-8,12,20-21,27-28H,3-6,9-11,13-14H2,1-2H3,(H,24,25)/t20-,21+/m0/s1 |
| InChIKey | BWHZCQVYSKVTRL-LEWJYISDSA-N |
| XLogP | 2.88 |
| TPSA | 81.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |