C24H33NO6 — CID 155995010
(4R,5R,6R,7S)-9-[(3-methoxyphenyl)methyl]-2-oxa-9-azabicyclo[12.4.0]octadeca-1(18),14,16-triene-4,5,6,7-tetrol (PubChem CID 155995010) has the molecular formula C24H33NO6 and a molecular weight of 431.53 g/mol. Its IUPAC name is (4R,5R,6R,7S)-9-[(3-methoxyphenyl)methyl]-2-oxa-9-azabicyclo[12.4.0]octadeca-1(18),14,16-triene-4,5,6,7-tetrol.
| Compound Name | (4R,5R,6R,7S)-9-[(3-methoxyphenyl)methyl]-2-oxa-9-azabicyclo[12.4.0]octadeca-1(18),14,16-triene-4,5,6,7-tetrol |
|---|---|
| PubChem CID | 155995010 |
| Molecular Formula | C24H33NO6 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | (4R,5R,6R,7S)-9-[(3-methoxyphenyl)methyl]-2-oxa-9-azabicyclo[12.4.0]octadeca-1(18),14,16-triene-4,5,6,7-tetrol |
| SMILES | COc1cccc(CN2CCCCc3ccccc3OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C2)c1 |
| InChI | InChI=1S/C24H33NO6/c1-30-19-10-6-7-17(13-19)14-25-12-5-4-9-18-8-2-3-11-22(18)31-16-21(27)24(29)23(28)20(26)15-25/h2-3,6-8,10-11,13,20-21,23-24,26-29H,4-5,9,12,14-16H2,1H3/t20-,21+,23+,24+/m0/s1 |
| InChIKey | RGUWVEKXCMSHBX-XWVZOOPGSA-N |
| XLogP | 1.36 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |