About N,N'-bis(3-aminopropyl)-2-[(3-aminopropylamino)methyl]-2-methylpropane-1,3-diamine
N,N'-bis(3-aminopropyl)-2-[(3-aminopropylamino)methyl]-2-methylpropane-1,3-diamine (PubChem CID 11007372) has the molecular formula C14H36N6
and a molecular weight of 288.48 g/mol. Its IUPAC name is N,N'-bis(3-aminopropyl)-2-[(3-aminopropylamino)methyl]-2-methylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N,N'-bis(3-aminopropyl)-2-[(3-aminopropylamino)methyl]-2-methylpropane-1,3-diamine |
| PubChem CID | 11007372 |
| Molecular Formula | C14H36N6 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.30 |
| IUPAC Name | N,N'-bis(3-aminopropyl)-2-[(3-aminopropylamino)methyl]-2-methylpropane-1,3-diamine |
| SMILES | CC(CNCCCN)(CNCCCN)CNCCCN |
| InChI | InChI=1S/C14H36N6/c1-14(11-18-8-2-5-15,12-19-9-3-6-16)13-20-10-4-7-17/h18-20H,2-13,15-17H2,1H3 |
| InChIKey | ABEAQDRCGMIZJI-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis(3-aminopropyl)-2-[(3-aminopropylamino)methyl]-2-methylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis(3-aminopropyl)-2-[(3-aminopropylamino)methyl]-2-methylpropane-1,3-diamine?
The IUPAC name of N,N'-bis(3-aminopropyl)-2-[(3-aminopropylamino)methyl]-2-methylpropane-1,3-diamine (CID 11007372) is N,N'-bis(3-aminopropyl)-2-[(3-aminopropylamino)methyl]-2-methylpropane-1,3-diamine.
What is the SMILES notation for N,N'-bis(3-aminopropyl)-2-[(3-aminopropylamino)methyl]-2-methylpropane-1,3-diamine?
The canonical SMILES for N,N'-bis(3-aminopropyl)-2-[(3-aminopropylamino)methyl]-2-methylpropane-1,3-diamine is CC(CNCCCN)(CNCCCN)CNCCCN.
What is the InChIKey of N,N'-bis(3-aminopropyl)-2-[(3-aminopropylamino)methyl]-2-methylpropane-1,3-diamine?
The InChIKey is ABEAQDRCGMIZJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H36N6/c1-14(11-18-8-2-5-15,12-19-9-3-6-16)13-20-10-4-7-17/h18-20H,2-13,15-17H2,1H3.
What are the key properties of N,N'-bis(3-aminopropyl)-2-[(3-aminopropylamino)methyl]-2-methylpropane-1,3-diamine?
N,N'-bis(3-aminopropyl)-2-[(3-aminopropylamino)methyl]-2-methylpropane-1,3-diamine has a molecular weight of 288.48 g/mol, XLogP of -1.19, 15 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(3-aminopropyl)-2-[(3-aminopropylamino)methyl]-2-methylpropane-1,3-diamine is sourced from PubChem (CID 11007372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).