C27H31Cl2N3O4 — CID 110074542
1'-(2,6-dichlorobenzoyl)-5-methylspiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,4'-piperidine]-6,13-dione (PubChem CID 110074542) has the molecular formula C27H31Cl2N3O4 and a molecular weight of 532.47 g/mol. Its IUPAC name is 1'-(2,6-dichlorobenzoyl)-5-methylspiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,4'-piperidine]-6,13-dione.
| Compound Name | 1'-(2,6-dichlorobenzoyl)-5-methylspiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,4'-piperidine]-6,13-dione |
|---|---|
| PubChem CID | 110074542 |
| Molecular Formula | C27H31Cl2N3O4 |
| Molecular Weight | 532.47 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | 1'-(2,6-dichlorobenzoyl)-5-methylspiro[2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-triene-7,4'-piperidine]-6,13-dione |
| SMILES | CN1CCOc2ccccc2C(=O)NCCCCC2(CCN(C(=O)c3c(Cl)cccc3Cl)CC2)C1=O |
| InChI | InChI=1S/C27H31Cl2N3O4/c1-31-17-18-36-22-10-3-2-7-19(22)24(33)30-14-5-4-11-27(26(31)35)12-15-32(16-13-27)25(34)23-20(28)8-6-9-21(23)29/h2-3,6-10H,4-5,11-18H2,1H3,(H,30,33) |
| InChIKey | TVQZSPOGNCNQIL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |