C24H34ClN5O3 — CID 110075120
1-[14-chloro-9-(1,3-dimethylpyrazole-4-carbonyl)-6-propan-2-yl-2,6,9-triazabicyclo[9.4.0]pentadeca-1(11),12,14-trien-2-yl]-2-methoxyethanone (PubChem CID 110075120) has the molecular formula C24H34ClN5O3 and a molecular weight of 476.02 g/mol. Its IUPAC name is 1-[14-chloro-9-(1,3-dimethylpyrazole-4-carbonyl)-6-propan-2-yl-2,6,9-triazabicyclo[9.4.0]pentadeca-1(11),12,14-trien-2-yl]-2-methoxyethanone.
| Compound Name | 1-[14-chloro-9-(1,3-dimethylpyrazole-4-carbonyl)-6-propan-2-yl-2,6,9-triazabicyclo[9.4.0]pentadeca-1(11),12,14-trien-2-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 110075120 |
| Molecular Formula | C24H34ClN5O3 |
| Molecular Weight | 476.02 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | 1-[14-chloro-9-(1,3-dimethylpyrazole-4-carbonyl)-6-propan-2-yl-2,6,9-triazabicyclo[9.4.0]pentadeca-1(11),12,14-trien-2-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CCCN(C(C)C)CCN(C(=O)c2cn(C)nc2C)Cc2ccc(Cl)cc21 |
| InChI | InChI=1S/C24H34ClN5O3/c1-17(2)28-9-6-10-30(23(31)16-33-5)22-13-20(25)8-7-19(22)14-29(12-11-28)24(32)21-15-27(4)26-18(21)3/h7-8,13,15,17H,6,9-12,14,16H2,1-5H3 |
| InChIKey | NTSHOTKAGSLOFT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 70.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.02 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |