C23H32ClN3O3S2 — CID 133071769
(14-chloro-2-methylsulfonyl-6-propan-2-yl-2,6,9-triazabicyclo[9.4.0]pentadeca-1(11),12,14-trien-9-yl)-(2,5-dimethylthiophen-3-yl)methanone (PubChem CID 133071769) has the molecular formula C23H32ClN3O3S2 and a molecular weight of 498.11 g/mol. Its IUPAC name is (14-chloro-2-methylsulfonyl-6-propan-2-yl-2,6,9-triazabicyclo[9.4.0]pentadeca-1(11),12,14-trien-9-yl)-(2,5-dimethylthiophen-3-yl)methanone.
| Compound Name | (14-chloro-2-methylsulfonyl-6-propan-2-yl-2,6,9-triazabicyclo[9.4.0]pentadeca-1(11),12,14-trien-9-yl)-(2,5-dimethylthiophen-3-yl)methanone |
|---|---|
| PubChem CID | 133071769 |
| Molecular Formula | C23H32ClN3O3S2 |
| Molecular Weight | 498.11 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | (14-chloro-2-methylsulfonyl-6-propan-2-yl-2,6,9-triazabicyclo[9.4.0]pentadeca-1(11),12,14-trien-9-yl)-(2,5-dimethylthiophen-3-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCN(C(C)C)CCCN(S(C)(=O)=O)c3cc(Cl)ccc3C2)c(C)s1 |
| InChI | InChI=1S/C23H32ClN3O3S2/c1-16(2)25-9-6-10-27(32(5,29)30)22-14-20(24)8-7-19(22)15-26(12-11-25)23(28)21-13-17(3)31-18(21)4/h7-8,13-14,16H,6,9-12,15H2,1-5H3 |
| InChIKey | BIHJZLKHNZNDTC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.11 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |