C27H27N3O3 — CID 110075912
4-(3-methoxybenzoyl)-1-prop-2-enyl-3-[(4-pyridin-4-ylphenyl)methyl]piperazin-2-one (PubChem CID 110075912) has the molecular formula C27H27N3O3 and a molecular weight of 441.53 g/mol. Its IUPAC name is 4-(3-methoxybenzoyl)-1-prop-2-enyl-3-[(4-pyridin-4-ylphenyl)methyl]piperazin-2-one.
| Compound Name | 4-(3-methoxybenzoyl)-1-prop-2-enyl-3-[(4-pyridin-4-ylphenyl)methyl]piperazin-2-one |
|---|---|
| PubChem CID | 110075912 |
| Molecular Formula | C27H27N3O3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 4-(3-methoxybenzoyl)-1-prop-2-enyl-3-[(4-pyridin-4-ylphenyl)methyl]piperazin-2-one |
| SMILES | C=CCN1CCN(C(=O)c2cccc(OC)c2)C(Cc2ccc(-c3ccncc3)cc2)C1=O |
| InChI | InChI=1S/C27H27N3O3/c1-3-15-29-16-17-30(26(31)23-5-4-6-24(19-23)33-2)25(27(29)32)18-20-7-9-21(10-8-20)22-11-13-28-14-12-22/h3-14,19,25H,1,15-18H2,2H3 |
| InChIKey | UGMUICQUBSSPBG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|