C26H26N4O2 — CID 110088273
1-prop-2-enyl-4-(2-pyridin-2-ylacetyl)-3-[(3-pyridin-4-ylphenyl)methyl]piperazin-2-one (PubChem CID 110088273) has the molecular formula C26H26N4O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 1-prop-2-enyl-4-(2-pyridin-2-ylacetyl)-3-[(3-pyridin-4-ylphenyl)methyl]piperazin-2-one.
| Compound Name | 1-prop-2-enyl-4-(2-pyridin-2-ylacetyl)-3-[(3-pyridin-4-ylphenyl)methyl]piperazin-2-one |
|---|---|
| PubChem CID | 110088273 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 1-prop-2-enyl-4-(2-pyridin-2-ylacetyl)-3-[(3-pyridin-4-ylphenyl)methyl]piperazin-2-one |
| SMILES | C=CCN1CCN(C(=O)Cc2ccccn2)C(Cc2cccc(-c3ccncc3)c2)C1=O |
| InChI | InChI=1S/C26H26N4O2/c1-2-14-29-15-16-30(25(31)19-23-8-3-4-11-28-23)24(26(29)32)18-20-6-5-7-22(17-20)21-9-12-27-13-10-21/h2-13,17,24H,1,14-16,18-19H2 |
| InChIKey | NQMVDRKGQAYUSE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|