C25H29N3O2 — CID 110088291
4-(cyclopentanecarbonyl)-1-prop-2-enyl-3-[(3-pyridin-3-ylphenyl)methyl]piperazin-2-one (PubChem CID 110088291) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 4-(cyclopentanecarbonyl)-1-prop-2-enyl-3-[(3-pyridin-3-ylphenyl)methyl]piperazin-2-one.
| Compound Name | 4-(cyclopentanecarbonyl)-1-prop-2-enyl-3-[(3-pyridin-3-ylphenyl)methyl]piperazin-2-one |
|---|---|
| PubChem CID | 110088291 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 4-(cyclopentanecarbonyl)-1-prop-2-enyl-3-[(3-pyridin-3-ylphenyl)methyl]piperazin-2-one |
| SMILES | C=CCN1CCN(C(=O)C2CCCC2)C(Cc2cccc(-c3cccnc3)c2)C1=O |
| InChI | InChI=1S/C25H29N3O2/c1-2-13-27-14-15-28(24(29)20-8-3-4-9-20)23(25(27)30)17-19-7-5-10-21(16-19)22-11-6-12-26-18-22/h2,5-7,10-12,16,18,20,23H,1,3-4,8-9,13-15,17H2 |
| InChIKey | JNNFSBLHPMZEMT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|