C22H21N5O2 — CID 124970385
(3R)-1-methyl-4-(pyrazine-2-carbonyl)-3-[(3-pyridin-3-ylphenyl)methyl]piperazin-2-one (PubChem CID 124970385) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is (3R)-1-methyl-4-(pyrazine-2-carbonyl)-3-[(3-pyridin-3-ylphenyl)methyl]piperazin-2-one.
| Compound Name | (3R)-1-methyl-4-(pyrazine-2-carbonyl)-3-[(3-pyridin-3-ylphenyl)methyl]piperazin-2-one |
|---|---|
| PubChem CID | 124970385 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | (3R)-1-methyl-4-(pyrazine-2-carbonyl)-3-[(3-pyridin-3-ylphenyl)methyl]piperazin-2-one |
| SMILES | CN1CCN(C(=O)c2cnccn2)[C@H](Cc2cccc(-c3cccnc3)c2)C1=O |
| InChI | InChI=1S/C22H21N5O2/c1-26-10-11-27(21(28)19-15-24-8-9-25-19)20(22(26)29)13-16-4-2-5-17(12-16)18-6-3-7-23-14-18/h2-9,12,14-15,20H,10-11,13H2,1H3/t20-/m1/s1 |
| InChIKey | JPTKCRYFLVGPRY-HXUWFJFHSA-N |
| XLogP | 2.06 |
| TPSA | 79.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |