C27H29N3O3 — CID 110250479
4-[3-(2-methoxyphenyl)propanoyl]-1-methyl-3-[(3-pyridin-4-ylphenyl)methyl]piperazin-2-one (PubChem CID 110250479) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is 4-[3-(2-methoxyphenyl)propanoyl]-1-methyl-3-[(3-pyridin-4-ylphenyl)methyl]piperazin-2-one.
| Compound Name | 4-[3-(2-methoxyphenyl)propanoyl]-1-methyl-3-[(3-pyridin-4-ylphenyl)methyl]piperazin-2-one |
|---|---|
| PubChem CID | 110250479 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 4-[3-(2-methoxyphenyl)propanoyl]-1-methyl-3-[(3-pyridin-4-ylphenyl)methyl]piperazin-2-one |
| SMILES | COc1ccccc1CCC(=O)N1CCN(C)C(=O)C1Cc1cccc(-c2ccncc2)c1 |
| InChI | InChI=1S/C27H29N3O3/c1-29-16-17-30(26(31)11-10-22-7-3-4-9-25(22)33-2)24(27(29)32)19-20-6-5-8-23(18-20)21-12-14-28-15-13-21/h3-9,12-15,18,24H,10-11,16-17,19H2,1-2H3 |
| InChIKey | ZZEIJXYPFQSGMN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |