C27H29N3O2 — CID 129453365
(3R)-1-ethyl-3-[(2-phenylphenyl)methyl]-4-(3-pyridin-3-ylpropanoyl)piperazin-2-one (PubChem CID 129453365) has the molecular formula C27H29N3O2 and a molecular weight of 427.55 g/mol. Its IUPAC name is (3R)-1-ethyl-3-[(2-phenylphenyl)methyl]-4-(3-pyridin-3-ylpropanoyl)piperazin-2-one.
| Compound Name | (3R)-1-ethyl-3-[(2-phenylphenyl)methyl]-4-(3-pyridin-3-ylpropanoyl)piperazin-2-one |
|---|---|
| PubChem CID | 129453365 |
| Molecular Formula | C27H29N3O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | (3R)-1-ethyl-3-[(2-phenylphenyl)methyl]-4-(3-pyridin-3-ylpropanoyl)piperazin-2-one |
| SMILES | CCN1CCN(C(=O)CCc2cccnc2)[C@H](Cc2ccccc2-c2ccccc2)C1=O |
| InChI | InChI=1S/C27H29N3O2/c1-2-29-17-18-30(26(31)15-14-21-9-8-16-28-20-21)25(27(29)32)19-23-12-6-7-13-24(23)22-10-4-3-5-11-22/h3-13,16,20,25H,2,14-15,17-19H2,1H3/t25-/m1/s1 |
| InChIKey | AJVZOPBCVFJTSH-RUZDIDTESA-N |
| XLogP | 3.98 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |