C27H33N3O3 — CID 110088314
4-(1-acetylpiperidine-4-carbonyl)-1-ethyl-3-[(3-phenylphenyl)methyl]piperazin-2-one (PubChem CID 110088314) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is 4-(1-acetylpiperidine-4-carbonyl)-1-ethyl-3-[(3-phenylphenyl)methyl]piperazin-2-one.
| Compound Name | 4-(1-acetylpiperidine-4-carbonyl)-1-ethyl-3-[(3-phenylphenyl)methyl]piperazin-2-one |
|---|---|
| PubChem CID | 110088314 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 4-(1-acetylpiperidine-4-carbonyl)-1-ethyl-3-[(3-phenylphenyl)methyl]piperazin-2-one |
| SMILES | CCN1CCN(C(=O)C2CCN(C(C)=O)CC2)C(Cc2cccc(-c3ccccc3)c2)C1=O |
| InChI | InChI=1S/C27H33N3O3/c1-3-28-16-17-30(26(32)23-12-14-29(15-13-23)20(2)31)25(27(28)33)19-21-8-7-11-24(18-21)22-9-5-4-6-10-22/h4-11,18,23,25H,3,12-17,19H2,1-2H3 |
| InChIKey | UMQGZPJIAKYWRM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |