C25H29N3O3 — CID 92548435
(6S)-1-[(2S)-oxolane-2-carbonyl]-4-prop-2-enyl-6-[(3-pyridin-3-ylphenyl)methyl]-1,4-diazepan-5-one (PubChem CID 92548435) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is (6S)-1-[(2S)-oxolane-2-carbonyl]-4-prop-2-enyl-6-[(3-pyridin-3-ylphenyl)methyl]-1,4-diazepan-5-one.
| Compound Name | (6S)-1-[(2S)-oxolane-2-carbonyl]-4-prop-2-enyl-6-[(3-pyridin-3-ylphenyl)methyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 92548435 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | (6S)-1-[(2S)-oxolane-2-carbonyl]-4-prop-2-enyl-6-[(3-pyridin-3-ylphenyl)methyl]-1,4-diazepan-5-one |
| SMILES | C=CCN1CCN(C(=O)[C@@H]2CCCO2)C[C@H](Cc2cccc(-c3cccnc3)c2)C1=O |
| InChI | InChI=1S/C25H29N3O3/c1-2-11-27-12-13-28(25(30)23-9-5-14-31-23)18-22(24(27)29)16-19-6-3-7-20(15-19)21-8-4-10-26-17-21/h2-4,6-8,10,15,17,22-23H,1,5,9,11-14,16,18H2/t22-,23-/m0/s1 |
| InChIKey | WCCZLAHRYUAVRY-GOTSBHOMSA-N |
| XLogP | 2.94 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|