C26H29FN2O3 — CID 92548400
(6S)-6-[[3-(4-fluorophenyl)phenyl]methyl]-1-[(2S)-oxolane-2-carbonyl]-4-prop-2-enyl-1,4-diazepan-5-one (PubChem CID 92548400) has the molecular formula C26H29FN2O3 and a molecular weight of 436.53 g/mol. Its IUPAC name is (6S)-6-[[3-(4-fluorophenyl)phenyl]methyl]-1-[(2S)-oxolane-2-carbonyl]-4-prop-2-enyl-1,4-diazepan-5-one.
| Compound Name | (6S)-6-[[3-(4-fluorophenyl)phenyl]methyl]-1-[(2S)-oxolane-2-carbonyl]-4-prop-2-enyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 92548400 |
| Molecular Formula | C26H29FN2O3 |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | (6S)-6-[[3-(4-fluorophenyl)phenyl]methyl]-1-[(2S)-oxolane-2-carbonyl]-4-prop-2-enyl-1,4-diazepan-5-one |
| SMILES | C=CCN1CCN(C(=O)[C@@H]2CCCO2)C[C@H](Cc2cccc(-c3ccc(F)cc3)c2)C1=O |
| InChI | InChI=1S/C26H29FN2O3/c1-2-12-28-13-14-29(26(31)24-7-4-15-32-24)18-22(25(28)30)17-19-5-3-6-21(16-19)20-8-10-23(27)11-9-20/h2-3,5-6,8-11,16,22,24H,1,4,7,12-15,17-18H2/t22-,24-/m0/s1 |
| InChIKey | CLVYGGSZICRAOT-UPVQGACJSA-N |
| XLogP | 3.69 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|