About 1-[3-(oxolan-2-yl)propanoyl]-6-[(2-phenylphenyl)methyl]-4-prop-2-enyl-1,4-diazepan-5-one
1-[3-(oxolan-2-yl)propanoyl]-6-[(2-phenylphenyl)methyl]-4-prop-2-enyl-1,4-diazepan-5-one (PubChem CID 110230264) has the molecular formula C28H34N2O3
and a molecular weight of 446.59 g/mol. Its IUPAC name is 1-[3-(oxolan-2-yl)propanoyl]-6-[(2-phenylphenyl)methyl]-4-prop-2-enyl-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 1-[3-(oxolan-2-yl)propanoyl]-6-[(2-phenylphenyl)methyl]-4-prop-2-enyl-1,4-diazepan-5-one |
| PubChem CID | 110230264 |
| Molecular Formula | C28H34N2O3 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | 1-[3-(oxolan-2-yl)propanoyl]-6-[(2-phenylphenyl)methyl]-4-prop-2-enyl-1,4-diazepan-5-one |
| SMILES | C=CCN1CCN(C(=O)CCC2CCCO2)CC(Cc2ccccc2-c2ccccc2)C1=O |
| InChI | InChI=1S/C28H34N2O3/c1-2-16-29-17-18-30(27(31)15-14-25-12-8-19-33-25)21-24(28(29)32)20-23-11-6-7-13-26(23)22-9-4-3-5-10-22/h2-7,9-11,13,24-25H,1,8,12,14-21H2 |
| InChIKey | XTVUWVLCLLYHDH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(oxolan-2-yl)propanoyl]-6-[(2-phenylphenyl)methyl]-4-prop-2-enyl-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(oxolan-2-yl)propanoyl]-6-[(2-phenylphenyl)methyl]-4-prop-2-enyl-1,4-diazepan-5-one?
The IUPAC name of 1-[3-(oxolan-2-yl)propanoyl]-6-[(2-phenylphenyl)methyl]-4-prop-2-enyl-1,4-diazepan-5-one (CID 110230264) is 1-[3-(oxolan-2-yl)propanoyl]-6-[(2-phenylphenyl)methyl]-4-prop-2-enyl-1,4-diazepan-5-one.
What is the SMILES notation for 1-[3-(oxolan-2-yl)propanoyl]-6-[(2-phenylphenyl)methyl]-4-prop-2-enyl-1,4-diazepan-5-one?
The canonical SMILES for 1-[3-(oxolan-2-yl)propanoyl]-6-[(2-phenylphenyl)methyl]-4-prop-2-enyl-1,4-diazepan-5-one is C=CCN1CCN(C(=O)CCC2CCCO2)CC(Cc2ccccc2-c2ccccc2)C1=O.
What is the InChIKey of 1-[3-(oxolan-2-yl)propanoyl]-6-[(2-phenylphenyl)methyl]-4-prop-2-enyl-1,4-diazepan-5-one?
The InChIKey is XTVUWVLCLLYHDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H34N2O3/c1-2-16-29-17-18-30(27(31)15-14-25-12-8-19-33-25)21-24(28(29)32)20-23-11-6-7-13-26(23)22-9-4-3-5-10-22/h2-7,9-11,13,24-25H,1,8,12,14-21H2.
What are the key properties of 1-[3-(oxolan-2-yl)propanoyl]-6-[(2-phenylphenyl)methyl]-4-prop-2-enyl-1,4-diazepan-5-one?
1-[3-(oxolan-2-yl)propanoyl]-6-[(2-phenylphenyl)methyl]-4-prop-2-enyl-1,4-diazepan-5-one has a molecular weight of 446.59 g/mol, XLogP of 4.33, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(oxolan-2-yl)propanoyl]-6-[(2-phenylphenyl)methyl]-4-prop-2-enyl-1,4-diazepan-5-one is sourced from PubChem (CID 110230264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).