C28H34N2O3 — CID 110230264
1-[3-(oxolan-2-yl)propanoyl]-6-[(2-phenylphenyl)methyl]-4-prop-2-enyl-1,4-diazepan-5-one (PubChem CID 110230264) has the molecular formula C28H34N2O3 and a molecular weight of 446.59 g/mol. Its IUPAC name is 1-[3-(oxolan-2-yl)propanoyl]-6-[(2-phenylphenyl)methyl]-4-prop-2-enyl-1,4-diazepan-5-one.
| Compound Name | 1-[3-(oxolan-2-yl)propanoyl]-6-[(2-phenylphenyl)methyl]-4-prop-2-enyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 110230264 |
| Molecular Formula | C28H34N2O3 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | 1-[3-(oxolan-2-yl)propanoyl]-6-[(2-phenylphenyl)methyl]-4-prop-2-enyl-1,4-diazepan-5-one |
| SMILES | C=CCN1CCN(C(=O)CCC2CCCO2)CC(Cc2ccccc2-c2ccccc2)C1=O |
| InChI | InChI=1S/C28H34N2O3/c1-2-16-29-17-18-30(27(31)15-14-25-12-8-19-33-25)21-24(28(29)32)20-23-11-6-7-13-26(23)22-9-4-3-5-10-22/h2-7,9-11,13,24-25H,1,8,12,14-21H2 |
| InChIKey | XTVUWVLCLLYHDH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|