C25H31N3O2 — CID 92578958
(6R)-1-(3-methylbutanoyl)-4-prop-2-enyl-6-[(2-pyridin-3-ylphenyl)methyl]-1,4-diazepan-5-one (PubChem CID 92578958) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is (6R)-1-(3-methylbutanoyl)-4-prop-2-enyl-6-[(2-pyridin-3-ylphenyl)methyl]-1,4-diazepan-5-one.
| Compound Name | (6R)-1-(3-methylbutanoyl)-4-prop-2-enyl-6-[(2-pyridin-3-ylphenyl)methyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 92578958 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | (6R)-1-(3-methylbutanoyl)-4-prop-2-enyl-6-[(2-pyridin-3-ylphenyl)methyl]-1,4-diazepan-5-one |
| SMILES | C=CCN1CCN(C(=O)CC(C)C)C[C@@H](Cc2ccccc2-c2cccnc2)C1=O |
| InChI | InChI=1S/C25H31N3O2/c1-4-12-27-13-14-28(24(29)15-19(2)3)18-22(25(27)30)16-20-8-5-6-10-23(20)21-9-7-11-26-17-21/h4-11,17,19,22H,1,12-16,18H2,2-3H3/t22-/m1/s1 |
| InChIKey | KMWNWCWZXIYQND-JOCHJYFZSA-N |
| XLogP | 3.81 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|