C24H28N2O2 — CID 92585340
(6R)-6-[(3-phenylphenyl)methyl]-1-propanoyl-4-prop-2-enyl-1,4-diazepan-5-one (PubChem CID 92585340) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is (6R)-6-[(3-phenylphenyl)methyl]-1-propanoyl-4-prop-2-enyl-1,4-diazepan-5-one.
| Compound Name | (6R)-6-[(3-phenylphenyl)methyl]-1-propanoyl-4-prop-2-enyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 92585340 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (6R)-6-[(3-phenylphenyl)methyl]-1-propanoyl-4-prop-2-enyl-1,4-diazepan-5-one |
| SMILES | C=CCN1CCN(C(=O)CC)C[C@@H](Cc2cccc(-c3ccccc3)c2)C1=O |
| InChI | InChI=1S/C24H28N2O2/c1-3-13-25-14-15-26(23(27)4-2)18-22(24(25)28)17-19-9-8-12-21(16-19)20-10-6-5-7-11-20/h3,5-12,16,22H,1,4,13-15,17-18H2,2H3/t22-/m1/s1 |
| InChIKey | RVCUMBWDNWYADP-JOCHJYFZSA-N |
| XLogP | 3.78 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|