C28H29N3O2 — CID 95850786
(6R)-6-[[3-(2-methylphenyl)phenyl]methyl]-4-prop-2-enyl-1-(pyridine-4-carbonyl)-1,4-diazepan-5-one (PubChem CID 95850786) has the molecular formula C28H29N3O2 and a molecular weight of 439.56 g/mol. Its IUPAC name is (6R)-6-[[3-(2-methylphenyl)phenyl]methyl]-4-prop-2-enyl-1-(pyridine-4-carbonyl)-1,4-diazepan-5-one.
| Compound Name | (6R)-6-[[3-(2-methylphenyl)phenyl]methyl]-4-prop-2-enyl-1-(pyridine-4-carbonyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 95850786 |
| Molecular Formula | C28H29N3O2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | (6R)-6-[[3-(2-methylphenyl)phenyl]methyl]-4-prop-2-enyl-1-(pyridine-4-carbonyl)-1,4-diazepan-5-one |
| SMILES | C=CCN1CCN(C(=O)c2ccncc2)C[C@@H](Cc2cccc(-c3ccccc3C)c2)C1=O |
| InChI | InChI=1S/C28H29N3O2/c1-3-15-30-16-17-31(27(32)23-11-13-29-14-12-23)20-25(28(30)33)19-22-8-6-9-24(18-22)26-10-5-4-7-21(26)2/h3-14,18,25H,1,15-17,19-20H2,2H3/t25-/m1/s1 |
| InChIKey | QKDWHNSHFIIVMH-RUZDIDTESA-N |
| XLogP | 4.39 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|