C26H25FN2O2 — CID 92562194
(6R)-1-(3-fluorobenzoyl)-6-[[3-(2-methylphenyl)phenyl]methyl]-1,4-diazepan-5-one (PubChem CID 92562194) has the molecular formula C26H25FN2O2 and a molecular weight of 416.50 g/mol. Its IUPAC name is (6R)-1-(3-fluorobenzoyl)-6-[[3-(2-methylphenyl)phenyl]methyl]-1,4-diazepan-5-one.
| Compound Name | (6R)-1-(3-fluorobenzoyl)-6-[[3-(2-methylphenyl)phenyl]methyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 92562194 |
| Molecular Formula | C26H25FN2O2 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | (6R)-1-(3-fluorobenzoyl)-6-[[3-(2-methylphenyl)phenyl]methyl]-1,4-diazepan-5-one |
| SMILES | Cc1ccccc1-c1cccc(C[C@@H]2CN(C(=O)c3cccc(F)c3)CCNC2=O)c1 |
| InChI | InChI=1S/C26H25FN2O2/c1-18-6-2-3-11-24(18)20-8-4-7-19(14-20)15-22-17-29(13-12-28-25(22)30)26(31)21-9-5-10-23(27)16-21/h2-11,14,16,22H,12-13,15,17H2,1H3,(H,28,30)/t22-/m1/s1 |
| InChIKey | SYPUMAFLEUIVOE-JOCHJYFZSA-N |
| XLogP | 4.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |