C18H17FN2O2 — CID 110657161
4-(3-fluorobenzoyl)-3-(2-methylphenyl)piperazin-2-one (PubChem CID 110657161) has the molecular formula C18H17FN2O2 and a molecular weight of 312.34 g/mol. Its IUPAC name is 4-(3-fluorobenzoyl)-3-(2-methylphenyl)piperazin-2-one.
| Compound Name | 4-(3-fluorobenzoyl)-3-(2-methylphenyl)piperazin-2-one |
|---|---|
| PubChem CID | 110657161 |
| Molecular Formula | C18H17FN2O2 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 4-(3-fluorobenzoyl)-3-(2-methylphenyl)piperazin-2-one |
| SMILES | Cc1ccccc1C1C(=O)NCCN1C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C18H17FN2O2/c1-12-5-2-3-8-15(12)16-17(22)20-9-10-21(16)18(23)13-6-4-7-14(19)11-13/h2-8,11,16H,9-10H2,1H3,(H,20,22) |
| InChIKey | IJIZGUDEPANLFO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |