C27H28N2O4 — CID 110230387
1-(2,3-dimethoxybenzoyl)-6-[(3-phenylphenyl)methyl]-1,4-diazepan-5-one (PubChem CID 110230387) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is 1-(2,3-dimethoxybenzoyl)-6-[(3-phenylphenyl)methyl]-1,4-diazepan-5-one.
| Compound Name | 1-(2,3-dimethoxybenzoyl)-6-[(3-phenylphenyl)methyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 110230387 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 1-(2,3-dimethoxybenzoyl)-6-[(3-phenylphenyl)methyl]-1,4-diazepan-5-one |
| SMILES | COc1cccc(C(=O)N2CCNC(=O)C(Cc3cccc(-c4ccccc4)c3)C2)c1OC |
| InChI | InChI=1S/C27H28N2O4/c1-32-24-13-7-12-23(25(24)33-2)27(31)29-15-14-28-26(30)22(18-29)17-19-8-6-11-21(16-19)20-9-4-3-5-10-20/h3-13,16,22H,14-15,17-18H2,1-2H3,(H,28,30) |
| InChIKey | MEEAHOBCXOWFCZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |