C26H25ClN6O — CID 110076041
1-[2-[2-(3-chlorophenyl)pyrimidin-4-yl]pyrrolidin-1-yl]-4-(quinazolin-4-ylamino)butan-1-one (PubChem CID 110076041) has the molecular formula C26H25ClN6O and a molecular weight of 472.98 g/mol. Its IUPAC name is 1-[2-[2-(3-chlorophenyl)pyrimidin-4-yl]pyrrolidin-1-yl]-4-(quinazolin-4-ylamino)butan-1-one.
| Compound Name | 1-[2-[2-(3-chlorophenyl)pyrimidin-4-yl]pyrrolidin-1-yl]-4-(quinazolin-4-ylamino)butan-1-one |
|---|---|
| PubChem CID | 110076041 |
| Molecular Formula | C26H25ClN6O |
| Molecular Weight | 472.98 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 1-[2-[2-(3-chlorophenyl)pyrimidin-4-yl]pyrrolidin-1-yl]-4-(quinazolin-4-ylamino)butan-1-one |
| SMILES | O=C(CCCNc1ncnc2ccccc12)N1CCCC1c1ccnc(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C26H25ClN6O/c27-19-7-3-6-18(16-19)25-29-14-12-22(32-25)23-10-5-15-33(23)24(34)11-4-13-28-26-20-8-1-2-9-21(20)30-17-31-26/h1-3,6-9,12,14,16-17,23H,4-5,10-11,13,15H2,(H,28,30,31) |
| InChIKey | SFXOLPURVQNJCG-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.98 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|