C22H23ClN6O — CID 110094941
1-[2-[2-(3-chlorophenyl)pyrimidin-4-yl]pyrrolidin-1-yl]-4-(pyrimidin-2-ylamino)butan-1-one (PubChem CID 110094941) has the molecular formula C22H23ClN6O and a molecular weight of 422.92 g/mol. Its IUPAC name is 1-[2-[2-(3-chlorophenyl)pyrimidin-4-yl]pyrrolidin-1-yl]-4-(pyrimidin-2-ylamino)butan-1-one.
| Compound Name | 1-[2-[2-(3-chlorophenyl)pyrimidin-4-yl]pyrrolidin-1-yl]-4-(pyrimidin-2-ylamino)butan-1-one |
|---|---|
| PubChem CID | 110094941 |
| Molecular Formula | C22H23ClN6O |
| Molecular Weight | 422.92 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 1-[2-[2-(3-chlorophenyl)pyrimidin-4-yl]pyrrolidin-1-yl]-4-(pyrimidin-2-ylamino)butan-1-one |
| SMILES | O=C(CCCNc1ncccn1)N1CCCC1c1ccnc(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C22H23ClN6O/c23-17-6-1-5-16(15-17)21-24-13-9-18(28-21)19-7-3-14-29(19)20(30)8-2-10-25-22-26-11-4-12-27-22/h1,4-6,9,11-13,15,19H,2-3,7-8,10,14H2,(H,25,26,27) |
| InChIKey | SMSPVTKYWHRGRN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.92 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|