C25H26F3N3O3 — CID 110076044
[4-(2-methoxyethoxy)phenyl]-[2-[4-[4-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]methanone (PubChem CID 110076044) has the molecular formula C25H26F3N3O3 and a molecular weight of 473.50 g/mol. Its IUPAC name is [4-(2-methoxyethoxy)phenyl]-[2-[4-[4-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]methanone.
| Compound Name | [4-(2-methoxyethoxy)phenyl]-[2-[4-[4-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 110076044 |
| Molecular Formula | C25H26F3N3O3 |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | [4-(2-methoxyethoxy)phenyl]-[2-[4-[4-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]methanone |
| SMILES | COCCOc1ccc(C(=O)N2CCCCC2c2[nH]ncc2-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C25H26F3N3O3/c1-33-14-15-34-20-11-7-18(8-12-20)24(32)31-13-3-2-4-22(31)23-21(16-29-30-23)17-5-9-19(10-6-17)25(26,27)28/h5-12,16,22H,2-4,13-15H2,1H3,(H,29,30) |
| InChIKey | NCFPHEJACHYMSF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|