C23H25F3N4O3 — CID 125012266
1-[3-oxo-3-[(2R)-2-[4-[4-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]propyl]piperidine-2,6-dione (PubChem CID 125012266) has the molecular formula C23H25F3N4O3 and a molecular weight of 462.47 g/mol. Its IUPAC name is 1-[3-oxo-3-[(2R)-2-[4-[4-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]propyl]piperidine-2,6-dione.
| Compound Name | 1-[3-oxo-3-[(2R)-2-[4-[4-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]propyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 125012266 |
| Molecular Formula | C23H25F3N4O3 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 1-[3-oxo-3-[(2R)-2-[4-[4-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]propyl]piperidine-2,6-dione |
| SMILES | O=C1CCCC(=O)N1CCC(=O)N1CCCC[C@@H]1c1[nH]ncc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H25F3N4O3/c24-23(25,26)16-9-7-15(8-10-16)17-14-27-28-22(17)18-4-1-2-12-29(18)21(33)11-13-30-19(31)5-3-6-20(30)32/h7-10,14,18H,1-6,11-13H2,(H,27,28)/t18-/m1/s1 |
| InChIKey | VWFGHJMLSUGEDE-GOSISDBHSA-N |
| XLogP | 4.08 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|