C23H20ClNO5 — CID 110076790
2-[2-[benzyl-[(2-hydroxyphenyl)methyl]amino]-2-oxoethoxy]-3-chlorobenzoic acid (PubChem CID 110076790) has the molecular formula C23H20ClNO5 and a molecular weight of 425.87 g/mol. Its IUPAC name is 2-[2-[benzyl-[(2-hydroxyphenyl)methyl]amino]-2-oxoethoxy]-3-chlorobenzoic acid.
| Compound Name | 2-[2-[benzyl-[(2-hydroxyphenyl)methyl]amino]-2-oxoethoxy]-3-chlorobenzoic acid |
|---|---|
| PubChem CID | 110076790 |
| Molecular Formula | C23H20ClNO5 |
| Molecular Weight | 425.87 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 2-[2-[benzyl-[(2-hydroxyphenyl)methyl]amino]-2-oxoethoxy]-3-chlorobenzoic acid |
| SMILES | O=C(O)c1cccc(Cl)c1OCC(=O)N(Cc1ccccc1)Cc1ccccc1O |
| InChI | InChI=1S/C23H20ClNO5/c24-19-11-6-10-18(23(28)29)22(19)30-15-21(27)25(13-16-7-2-1-3-8-16)14-17-9-4-5-12-20(17)26/h1-12,26H,13-15H2,(H,28,29) |
| InChIKey | PDMKEEDXWBFIDE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.87 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|