C27H33N3O3 — CID 110077162
3-[3-(2-cyclohexylbenzimidazol-1-yl)propanoyl-(2-phenylethyl)amino]propanoic acid (PubChem CID 110077162) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is 3-[3-(2-cyclohexylbenzimidazol-1-yl)propanoyl-(2-phenylethyl)amino]propanoic acid.
| Compound Name | 3-[3-(2-cyclohexylbenzimidazol-1-yl)propanoyl-(2-phenylethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 110077162 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 3-[3-(2-cyclohexylbenzimidazol-1-yl)propanoyl-(2-phenylethyl)amino]propanoic acid |
| SMILES | O=C(O)CCN(CCc1ccccc1)C(=O)CCn1c(C2CCCCC2)nc2ccccc21 |
| InChI | InChI=1S/C27H33N3O3/c31-25(29(19-17-26(32)33)18-15-21-9-3-1-4-10-21)16-20-30-24-14-8-7-13-23(24)28-27(30)22-11-5-2-6-12-22/h1,3-4,7-10,13-14,22H,2,5-6,11-12,15-20H2,(H,32,33) |
| InChIKey | NSQCNLZKPYDIAP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |