C15H13FN2O4 — CID 110082547
1-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-6-oxopyridine-3-carboxylic acid (PubChem CID 110082547) has the molecular formula C15H13FN2O4 and a molecular weight of 304.28 g/mol. Its IUPAC name is 1-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-6-oxopyridine-3-carboxylic acid.
| Compound Name | 1-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-6-oxopyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 110082547 |
| Molecular Formula | C15H13FN2O4 |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 1-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-6-oxopyridine-3-carboxylic acid |
| SMILES | O=C(Cn1cc(C(=O)O)ccc1=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C15H13FN2O4/c16-12-4-1-10(2-5-12)7-17-13(19)9-18-8-11(15(21)22)3-6-14(18)20/h1-6,8H,7,9H2,(H,17,19)(H,21,22) |
| InChIKey | WQQALBOVVFAJMU-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |