C22H31N5O3S — CID 110083010
azepan-1-yl-[5-[1-(2-pyridin-4-ylethylsulfonyl)piperidin-3-yl]-1H-pyrazol-4-yl]methanone (PubChem CID 110083010) has the molecular formula C22H31N5O3S and a molecular weight of 445.59 g/mol. Its IUPAC name is azepan-1-yl-[5-[1-(2-pyridin-4-ylethylsulfonyl)piperidin-3-yl]-1H-pyrazol-4-yl]methanone.
| Compound Name | azepan-1-yl-[5-[1-(2-pyridin-4-ylethylsulfonyl)piperidin-3-yl]-1H-pyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 110083010 |
| Molecular Formula | C22H31N5O3S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | azepan-1-yl-[5-[1-(2-pyridin-4-ylethylsulfonyl)piperidin-3-yl]-1H-pyrazol-4-yl]methanone |
| SMILES | O=C(c1cn[nH]c1C1CCCN(S(=O)(=O)CCc2ccncc2)C1)N1CCCCCC1 |
| InChI | InChI=1S/C22H31N5O3S/c28-22(26-12-3-1-2-4-13-26)20-16-24-25-21(20)19-6-5-14-27(17-19)31(29,30)15-9-18-7-10-23-11-8-18/h7-8,10-11,16,19H,1-6,9,12-15,17H2,(H,24,25) |
| InChIKey | IDXZVWKNKITKIH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |