C26H34N2O2 — CID 110083663
1-(2-ethylbutanoyl)-4-[[2-(2-methylphenyl)phenyl]methyl]piperidine-4-carboxamide (PubChem CID 110083663) has the molecular formula C26H34N2O2 and a molecular weight of 406.57 g/mol. Its IUPAC name is 1-(2-ethylbutanoyl)-4-[[2-(2-methylphenyl)phenyl]methyl]piperidine-4-carboxamide.
| Compound Name | 1-(2-ethylbutanoyl)-4-[[2-(2-methylphenyl)phenyl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 110083663 |
| Molecular Formula | C26H34N2O2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 1-(2-ethylbutanoyl)-4-[[2-(2-methylphenyl)phenyl]methyl]piperidine-4-carboxamide |
| SMILES | CCC(CC)C(=O)N1CCC(Cc2ccccc2-c2ccccc2C)(C(N)=O)CC1 |
| InChI | InChI=1S/C26H34N2O2/c1-4-20(5-2)24(29)28-16-14-26(15-17-28,25(27)30)18-21-11-7-9-13-23(21)22-12-8-6-10-19(22)3/h6-13,20H,4-5,14-18H2,1-3H3,(H2,27,30) |
| InChIKey | DFMMVAKOZAOAHC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |