C27H27FN2O2 — CID 110231021
3-[[2-(2-fluorophenyl)phenyl]methyl]-1-(3-phenylpropanoyl)pyrrolidine-3-carboxamide (PubChem CID 110231021) has the molecular formula C27H27FN2O2 and a molecular weight of 430.52 g/mol. Its IUPAC name is 3-[[2-(2-fluorophenyl)phenyl]methyl]-1-(3-phenylpropanoyl)pyrrolidine-3-carboxamide.
| Compound Name | 3-[[2-(2-fluorophenyl)phenyl]methyl]-1-(3-phenylpropanoyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 110231021 |
| Molecular Formula | C27H27FN2O2 |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 3-[[2-(2-fluorophenyl)phenyl]methyl]-1-(3-phenylpropanoyl)pyrrolidine-3-carboxamide |
| SMILES | NC(=O)C1(Cc2ccccc2-c2ccccc2F)CCN(C(=O)CCc2ccccc2)C1 |
| InChI | InChI=1S/C27H27FN2O2/c28-24-13-7-6-12-23(24)22-11-5-4-10-21(22)18-27(26(29)32)16-17-30(19-27)25(31)15-14-20-8-2-1-3-9-20/h1-13H,14-19H2,(H2,29,32) |
| InChIKey | BNAXAODCIHLJOU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |