C25H25N3O2 — CID 92574350
(3R)-1-(2-phenylacetyl)-3-[(2-pyridin-3-ylphenyl)methyl]pyrrolidine-3-carboxamide (PubChem CID 92574350) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is (3R)-1-(2-phenylacetyl)-3-[(2-pyridin-3-ylphenyl)methyl]pyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(2-phenylacetyl)-3-[(2-pyridin-3-ylphenyl)methyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 92574350 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | (3R)-1-(2-phenylacetyl)-3-[(2-pyridin-3-ylphenyl)methyl]pyrrolidine-3-carboxamide |
| SMILES | NC(=O)[C@]1(Cc2ccccc2-c2cccnc2)CCN(C(=O)Cc2ccccc2)C1 |
| InChI | InChI=1S/C25H25N3O2/c26-24(30)25(12-14-28(18-25)23(29)15-19-7-2-1-3-8-19)16-20-9-4-5-11-22(20)21-10-6-13-27-17-21/h1-11,13,17H,12,14-16,18H2,(H2,26,30)/t25-/m0/s1 |
| InChIKey | ZJKJYAIVXSWGGI-VWLOTQADSA-N |
| XLogP | 3.24 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |