C25H27N3O — CID 92574804
(3S)-1-benzyl-3-[(2-pyridin-3-ylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 92574804) has the molecular formula C25H27N3O and a molecular weight of 385.51 g/mol. Its IUPAC name is (3S)-1-benzyl-3-[(2-pyridin-3-ylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-benzyl-3-[(2-pyridin-3-ylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92574804 |
| Molecular Formula | C25H27N3O |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | (3S)-1-benzyl-3-[(2-pyridin-3-ylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | NC(=O)[C@]1(Cc2ccccc2-c2cccnc2)CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C25H27N3O/c26-24(29)25(13-7-15-28(19-25)18-20-8-2-1-3-9-20)16-21-10-4-5-12-23(21)22-11-6-14-27-17-22/h1-6,8-12,14,17H,7,13,15-16,18-19H2,(H2,26,29)/t25-/m0/s1 |
| InChIKey | XTRMLNVUZKHIMN-VWLOTQADSA-N |
| XLogP | 4.06 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |