C25H27N5O2 — CID 110083881
N-ethyl-1-(pyrazine-2-carbonyl)-4-[(3-pyridin-4-ylphenyl)methyl]piperidine-4-carboxamide (PubChem CID 110083881) has the molecular formula C25H27N5O2 and a molecular weight of 429.52 g/mol. Its IUPAC name is N-ethyl-1-(pyrazine-2-carbonyl)-4-[(3-pyridin-4-ylphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | N-ethyl-1-(pyrazine-2-carbonyl)-4-[(3-pyridin-4-ylphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 110083881 |
| Molecular Formula | C25H27N5O2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | N-ethyl-1-(pyrazine-2-carbonyl)-4-[(3-pyridin-4-ylphenyl)methyl]piperidine-4-carboxamide |
| SMILES | CCNC(=O)C1(Cc2cccc(-c3ccncc3)c2)CCN(C(=O)c2cnccn2)CC1 |
| InChI | InChI=1S/C25H27N5O2/c1-2-28-24(32)25(8-14-30(15-9-25)23(31)22-18-27-12-13-29-22)17-19-4-3-5-21(16-19)20-6-10-26-11-7-20/h3-7,10-13,16,18H,2,8-9,14-15,17H2,1H3,(H,28,32) |
| InChIKey | ANMBATPPEAGUOA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |