C26H28N4O2 — CID 110084101
1-benzoyl-N-ethyl-4-[(3-pyrimidin-5-ylphenyl)methyl]piperidine-4-carboxamide (PubChem CID 110084101) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 1-benzoyl-N-ethyl-4-[(3-pyrimidin-5-ylphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-benzoyl-N-ethyl-4-[(3-pyrimidin-5-ylphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 110084101 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 1-benzoyl-N-ethyl-4-[(3-pyrimidin-5-ylphenyl)methyl]piperidine-4-carboxamide |
| SMILES | CCNC(=O)C1(Cc2cccc(-c3cncnc3)c2)CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H28N4O2/c1-2-29-25(32)26(11-13-30(14-12-26)24(31)21-8-4-3-5-9-21)16-20-7-6-10-22(15-20)23-17-27-19-28-18-23/h3-10,15,17-19H,2,11-14,16H2,1H3,(H,29,32) |
| InChIKey | BHUNAFGJMXDGLK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |