C25H33NO3 — CID 110085030
4-[[3-(3,5-dimethylphenyl)phenyl]methyl]-N-(3-methoxypropyl)oxane-4-carboxamide (PubChem CID 110085030) has the molecular formula C25H33NO3 and a molecular weight of 395.54 g/mol. Its IUPAC name is 4-[[3-(3,5-dimethylphenyl)phenyl]methyl]-N-(3-methoxypropyl)oxane-4-carboxamide.
| Compound Name | 4-[[3-(3,5-dimethylphenyl)phenyl]methyl]-N-(3-methoxypropyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 110085030 |
| Molecular Formula | C25H33NO3 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | 4-[[3-(3,5-dimethylphenyl)phenyl]methyl]-N-(3-methoxypropyl)oxane-4-carboxamide |
| SMILES | COCCCNC(=O)C1(Cc2cccc(-c3cc(C)cc(C)c3)c2)CCOCC1 |
| InChI | InChI=1S/C25H33NO3/c1-19-14-20(2)16-23(15-19)22-7-4-6-21(17-22)18-25(8-12-29-13-9-25)24(27)26-10-5-11-28-3/h4,6-7,14-17H,5,8-13,18H2,1-3H3,(H,26,27) |
| InChIKey | MMDNDCZOHZDLTN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|