C25H32N2O3 — CID 129455278
N-(2-acetamidoethyl)-4-[[3-(3,5-dimethylphenyl)phenyl]methyl]oxane-4-carboxamide (PubChem CID 129455278) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-4-[[3-(3,5-dimethylphenyl)phenyl]methyl]oxane-4-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-4-[[3-(3,5-dimethylphenyl)phenyl]methyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 129455278 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | N-(2-acetamidoethyl)-4-[[3-(3,5-dimethylphenyl)phenyl]methyl]oxane-4-carboxamide |
| SMILES | CC(=O)NCCNC(=O)C1(Cc2cccc(-c3cc(C)cc(C)c3)c2)CCOCC1 |
| InChI | InChI=1S/C25H32N2O3/c1-18-13-19(2)15-23(14-18)22-6-4-5-21(16-22)17-25(7-11-30-12-8-25)24(29)27-10-9-26-20(3)28/h4-6,13-16H,7-12,17H2,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | HULBNFRJFHIGNG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|