About 4-[[3-(3,4-difluorophenyl)phenyl]methyl]-N-[(2S)-2-hydroxypropyl]oxane-4-carboxamide
4-[[3-(3,4-difluorophenyl)phenyl]methyl]-N-[(2S)-2-hydroxypropyl]oxane-4-carboxamide (PubChem CID 124938700) has the molecular formula C22H25F2NO3
and a molecular weight of 389.44 g/mol. Its IUPAC name is 4-[[3-(3,4-difluorophenyl)phenyl]methyl]-N-[(2S)-2-hydroxypropyl]oxane-4-carboxamide.
Molecular Properties
| Compound Name | 4-[[3-(3,4-difluorophenyl)phenyl]methyl]-N-[(2S)-2-hydroxypropyl]oxane-4-carboxamide |
| PubChem CID | 124938700 |
| Molecular Formula | C22H25F2NO3 |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 4-[[3-(3,4-difluorophenyl)phenyl]methyl]-N-[(2S)-2-hydroxypropyl]oxane-4-carboxamide |
| SMILES | C[C@H](O)CNC(=O)C1(Cc2cccc(-c3ccc(F)c(F)c3)c2)CCOCC1 |
| InChI | InChI=1S/C22H25F2NO3/c1-15(26)14-25-21(27)22(7-9-28-10-8-22)13-16-3-2-4-17(11-16)18-5-6-19(23)20(24)12-18/h2-6,11-12,15,26H,7-10,13-14H2,1H3,(H,25,27)/t15-/m0/s1 |
| InChIKey | DVZSXHXSGWRFOX-HNNXBMFYSA-N |
| XLogP | 3.47 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[3-(3,4-difluorophenyl)phenyl]methyl]-N-[(2S)-2-hydroxypropyl]oxane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3-(3,4-difluorophenyl)phenyl]methyl]-N-[(2S)-2-hydroxypropyl]oxane-4-carboxamide?
The IUPAC name of 4-[[3-(3,4-difluorophenyl)phenyl]methyl]-N-[(2S)-2-hydroxypropyl]oxane-4-carboxamide (CID 124938700) is 4-[[3-(3,4-difluorophenyl)phenyl]methyl]-N-[(2S)-2-hydroxypropyl]oxane-4-carboxamide.
What is the SMILES notation for 4-[[3-(3,4-difluorophenyl)phenyl]methyl]-N-[(2S)-2-hydroxypropyl]oxane-4-carboxamide?
The canonical SMILES for 4-[[3-(3,4-difluorophenyl)phenyl]methyl]-N-[(2S)-2-hydroxypropyl]oxane-4-carboxamide is C[C@H](O)CNC(=O)C1(Cc2cccc(-c3ccc(F)c(F)c3)c2)CCOCC1.
What is the InChIKey of 4-[[3-(3,4-difluorophenyl)phenyl]methyl]-N-[(2S)-2-hydroxypropyl]oxane-4-carboxamide?
The InChIKey is DVZSXHXSGWRFOX-HNNXBMFYSA-N. The full InChI is InChI=1S/C22H25F2NO3/c1-15(26)14-25-21(27)22(7-9-28-10-8-22)13-16-3-2-4-17(11-16)18-5-6-19(23)20(24)12-18/h2-6,11-12,15,26H,7-10,13-14H2,1H3,(H,25,27)/t15-/m0/s1.
What are the key properties of 4-[[3-(3,4-difluorophenyl)phenyl]methyl]-N-[(2S)-2-hydroxypropyl]oxane-4-carboxamide?
4-[[3-(3,4-difluorophenyl)phenyl]methyl]-N-[(2S)-2-hydroxypropyl]oxane-4-carboxamide has a molecular weight of 389.44 g/mol, XLogP of 3.47, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3-(3,4-difluorophenyl)phenyl]methyl]-N-[(2S)-2-hydroxypropyl]oxane-4-carboxamide is sourced from PubChem (CID 124938700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).