C25H25FN2O2 — CID 129458157
N-[(4-fluorophenyl)methyl]-4-[(3-pyridin-4-ylphenyl)methyl]oxane-4-carboxamide (PubChem CID 129458157) has the molecular formula C25H25FN2O2 and a molecular weight of 404.49 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-4-[(3-pyridin-4-ylphenyl)methyl]oxane-4-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-4-[(3-pyridin-4-ylphenyl)methyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 129458157 |
| Molecular Formula | C25H25FN2O2 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-4-[(3-pyridin-4-ylphenyl)methyl]oxane-4-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)C1(Cc2cccc(-c3ccncc3)c2)CCOCC1 |
| InChI | InChI=1S/C25H25FN2O2/c26-23-6-4-19(5-7-23)18-28-24(29)25(10-14-30-15-11-25)17-20-2-1-3-22(16-20)21-8-12-27-13-9-21/h1-9,12-13,16H,10-11,14-15,17-18H2,(H,28,29) |
| InChIKey | SDOIDKUDQOGFOX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |