C27H32FNO2 — CID 129459873
N-[2-(cyclohexen-1-yl)ethyl]-4-[[3-(4-fluorophenyl)phenyl]methyl]oxane-4-carboxamide (PubChem CID 129459873) has the molecular formula C27H32FNO2 and a molecular weight of 421.56 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-4-[[3-(4-fluorophenyl)phenyl]methyl]oxane-4-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-4-[[3-(4-fluorophenyl)phenyl]methyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 129459873 |
| Molecular Formula | C27H32FNO2 |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-4-[[3-(4-fluorophenyl)phenyl]methyl]oxane-4-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)C1(Cc2cccc(-c3ccc(F)cc3)c2)CCOCC1 |
| InChI | InChI=1S/C27H32FNO2/c28-25-11-9-23(10-12-25)24-8-4-7-22(19-24)20-27(14-17-31-18-15-27)26(30)29-16-13-21-5-2-1-3-6-21/h4-5,7-12,19H,1-3,6,13-18,20H2,(H,29,30) |
| InChIKey | ZAZCUSAOIYYNMT-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|