C28H34FNO3 — CID 129453770
N-[2-(cyclohexen-1-yl)ethyl]-4-[[4-(5-fluoro-2-methoxyphenyl)phenyl]methyl]oxane-4-carboxamide (PubChem CID 129453770) has the molecular formula C28H34FNO3 and a molecular weight of 451.58 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-4-[[4-(5-fluoro-2-methoxyphenyl)phenyl]methyl]oxane-4-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-4-[[4-(5-fluoro-2-methoxyphenyl)phenyl]methyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 129453770 |
| Molecular Formula | C28H34FNO3 |
| Molecular Weight | 451.58 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-4-[[4-(5-fluoro-2-methoxyphenyl)phenyl]methyl]oxane-4-carboxamide |
| SMILES | COc1ccc(F)cc1-c1ccc(CC2(C(=O)NCCC3=CCCCC3)CCOCC2)cc1 |
| InChI | InChI=1S/C28H34FNO3/c1-32-26-12-11-24(29)19-25(26)23-9-7-22(8-10-23)20-28(14-17-33-18-15-28)27(31)30-16-13-21-5-3-2-4-6-21/h5,7-12,19H,2-4,6,13-18,20H2,1H3,(H,30,31) |
| InChIKey | BQVPNUKQUNSKRK-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.58 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|