C24H29FN2O4 — CID 155983023
N-(2-acetamidoethyl)-4-[[4-(5-fluoro-2-methoxyphenyl)phenyl]methyl]oxane-4-carboxamide (PubChem CID 155983023) has the molecular formula C24H29FN2O4 and a molecular weight of 428.50 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-4-[[4-(5-fluoro-2-methoxyphenyl)phenyl]methyl]oxane-4-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-4-[[4-(5-fluoro-2-methoxyphenyl)phenyl]methyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 155983023 |
| Molecular Formula | C24H29FN2O4 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | N-(2-acetamidoethyl)-4-[[4-(5-fluoro-2-methoxyphenyl)phenyl]methyl]oxane-4-carboxamide |
| SMILES | COc1ccc(F)cc1-c1ccc(CC2(C(=O)NCCNC(C)=O)CCOCC2)cc1 |
| InChI | InChI=1S/C24H29FN2O4/c1-17(28)26-11-12-27-23(29)24(9-13-31-14-10-24)16-18-3-5-19(6-4-18)21-15-20(25)7-8-22(21)30-2/h3-8,15H,9-14,16H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | ZBOHMHFOSRQBRY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|