C25H30FNO3 — CID 129458761
N-cyclopentyl-4-[[3-(5-fluoro-2-methoxyphenyl)phenyl]methyl]oxane-4-carboxamide (PubChem CID 129458761) has the molecular formula C25H30FNO3 and a molecular weight of 411.52 g/mol. Its IUPAC name is N-cyclopentyl-4-[[3-(5-fluoro-2-methoxyphenyl)phenyl]methyl]oxane-4-carboxamide.
| Compound Name | N-cyclopentyl-4-[[3-(5-fluoro-2-methoxyphenyl)phenyl]methyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 129458761 |
| Molecular Formula | C25H30FNO3 |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | N-cyclopentyl-4-[[3-(5-fluoro-2-methoxyphenyl)phenyl]methyl]oxane-4-carboxamide |
| SMILES | COc1ccc(F)cc1-c1cccc(CC2(C(=O)NC3CCCC3)CCOCC2)c1 |
| InChI | InChI=1S/C25H30FNO3/c1-29-23-10-9-20(26)16-22(23)19-6-4-5-18(15-19)17-25(11-13-30-14-12-25)24(28)27-21-7-2-3-8-21/h4-6,9-10,15-16,21H,2-3,7-8,11-14,17H2,1H3,(H,27,28) |
| InChIKey | VAKMXNXIWWMKHY-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |