C25H30FNO4 — CID 129457040
4-[[3-(5-fluoro-2-methoxyphenyl)phenyl]methyl]-N-[(3R)-oxan-3-yl]oxane-4-carboxamide (PubChem CID 129457040) has the molecular formula C25H30FNO4 and a molecular weight of 427.52 g/mol. Its IUPAC name is 4-[[3-(5-fluoro-2-methoxyphenyl)phenyl]methyl]-N-[(3R)-oxan-3-yl]oxane-4-carboxamide.
| Compound Name | 4-[[3-(5-fluoro-2-methoxyphenyl)phenyl]methyl]-N-[(3R)-oxan-3-yl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 129457040 |
| Molecular Formula | C25H30FNO4 |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 4-[[3-(5-fluoro-2-methoxyphenyl)phenyl]methyl]-N-[(3R)-oxan-3-yl]oxane-4-carboxamide |
| SMILES | COc1ccc(F)cc1-c1cccc(CC2(C(=O)N[C@@H]3CCCOC3)CCOCC2)c1 |
| InChI | InChI=1S/C25H30FNO4/c1-29-23-8-7-20(26)15-22(23)19-5-2-4-18(14-19)16-25(9-12-30-13-10-25)24(28)27-21-6-3-11-31-17-21/h2,4-5,7-8,14-15,21H,3,6,9-13,16-17H2,1H3,(H,27,28)/t21-/m1/s1 |
| InChIKey | NXZSNPMYPBOOBR-OAQYLSRUSA-N |
| XLogP | 4.14 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |