C24H30FNO3 — CID 124938836
N-[(2S)-butan-2-yl]-4-[[3-(5-fluoro-2-methoxyphenyl)phenyl]methyl]oxane-4-carboxamide (PubChem CID 124938836) has the molecular formula C24H30FNO3 and a molecular weight of 399.51 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-4-[[3-(5-fluoro-2-methoxyphenyl)phenyl]methyl]oxane-4-carboxamide.
| Compound Name | N-[(2S)-butan-2-yl]-4-[[3-(5-fluoro-2-methoxyphenyl)phenyl]methyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 124938836 |
| Molecular Formula | C24H30FNO3 |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | N-[(2S)-butan-2-yl]-4-[[3-(5-fluoro-2-methoxyphenyl)phenyl]methyl]oxane-4-carboxamide |
| SMILES | CC[C@H](C)NC(=O)C1(Cc2cccc(-c3cc(F)ccc3OC)c2)CCOCC1 |
| InChI | InChI=1S/C24H30FNO3/c1-4-17(2)26-23(27)24(10-12-29-13-11-24)16-18-6-5-7-19(14-18)21-15-20(25)8-9-22(21)28-3/h5-9,14-15,17H,4,10-13,16H2,1-3H3,(H,26,27)/t17-/m0/s1 |
| InChIKey | TWNLUXLZJCCBIP-KRWDZBQOSA-N |
| XLogP | 4.76 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |