C30H41FN2O3 — CID 129457212
N-[3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]propyl]-4-[[3-(5-fluoro-2-methoxyphenyl)phenyl]methyl]oxane-4-carboxamide (PubChem CID 129457212) has the molecular formula C30H41FN2O3 and a molecular weight of 496.67 g/mol. Its IUPAC name is N-[3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]propyl]-4-[[3-(5-fluoro-2-methoxyphenyl)phenyl]methyl]oxane-4-carboxamide.
| Compound Name | N-[3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]propyl]-4-[[3-(5-fluoro-2-methoxyphenyl)phenyl]methyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 129457212 |
| Molecular Formula | C30H41FN2O3 |
| Molecular Weight | 496.67 g/mol |
| Exact Mass | 496.31 |
| IUPAC Name | N-[3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]propyl]-4-[[3-(5-fluoro-2-methoxyphenyl)phenyl]methyl]oxane-4-carboxamide |
| SMILES | COc1ccc(F)cc1-c1cccc(CC2(C(=O)NCCCN3[C@H](C)CCC[C@@H]3C)CCOCC2)c1 |
| InChI | InChI=1S/C30H41FN2O3/c1-22-7-4-8-23(2)33(22)16-6-15-32-29(34)30(13-17-36-18-14-30)21-24-9-5-10-25(19-24)27-20-26(31)11-12-28(27)35-3/h5,9-12,19-20,22-23H,4,6-8,13-18,21H2,1-3H3,(H,32,34)/t22-,23+ |
| InChIKey | OOINTZBSMCZSQG-ZRZAMGCNSA-N |
| XLogP | 5.61 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.67 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|