C27H36N2O3 — CID 129455548
4-[[4-(2-methoxyphenyl)phenyl]methyl]-N-(2-piperidin-1-ylethyl)oxane-4-carboxamide (PubChem CID 129455548) has the molecular formula C27H36N2O3 and a molecular weight of 436.60 g/mol. Its IUPAC name is 4-[[4-(2-methoxyphenyl)phenyl]methyl]-N-(2-piperidin-1-ylethyl)oxane-4-carboxamide.
| Compound Name | 4-[[4-(2-methoxyphenyl)phenyl]methyl]-N-(2-piperidin-1-ylethyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 129455548 |
| Molecular Formula | C27H36N2O3 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | 4-[[4-(2-methoxyphenyl)phenyl]methyl]-N-(2-piperidin-1-ylethyl)oxane-4-carboxamide |
| SMILES | COc1ccccc1-c1ccc(CC2(C(=O)NCCN3CCCCC3)CCOCC2)cc1 |
| InChI | InChI=1S/C27H36N2O3/c1-31-25-8-4-3-7-24(25)23-11-9-22(10-12-23)21-27(13-19-32-20-14-27)26(30)28-15-18-29-16-5-2-6-17-29/h3-4,7-12H,2,5-6,13-21H2,1H3,(H,28,30) |
| InChIKey | IRZQXEFUZRLBFE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |