C22H25F2NO3 — CID 110082612
4-[[4-(3,4-difluorophenyl)phenyl]methyl]-N-(3-hydroxypropyl)oxane-4-carboxamide (PubChem CID 110082612) has the molecular formula C22H25F2NO3 and a molecular weight of 389.44 g/mol. Its IUPAC name is 4-[[4-(3,4-difluorophenyl)phenyl]methyl]-N-(3-hydroxypropyl)oxane-4-carboxamide.
| Compound Name | 4-[[4-(3,4-difluorophenyl)phenyl]methyl]-N-(3-hydroxypropyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 110082612 |
| Molecular Formula | C22H25F2NO3 |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 4-[[4-(3,4-difluorophenyl)phenyl]methyl]-N-(3-hydroxypropyl)oxane-4-carboxamide |
| SMILES | O=C(NCCCO)C1(Cc2ccc(-c3ccc(F)c(F)c3)cc2)CCOCC1 |
| InChI | InChI=1S/C22H25F2NO3/c23-19-7-6-18(14-20(19)24)17-4-2-16(3-5-17)15-22(8-12-28-13-9-22)21(27)25-10-1-11-26/h2-7,14,26H,1,8-13,15H2,(H,25,27) |
| InChIKey | JZEZKCOUCNXHLB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|